Target Relevance

Molecular Definition

Canonical SMILES NC(=NC(=O)c1oc(cc1N)c2cccc(F)c2)N
Formula C12H11FN4O2
Molecular Weight 262.24 da
Stereocenters 0/0