Molecular Definition

Canonical SMILES CC1=C(C(NC(=O)N1)c2ccc(cc2)[N+](=O)[O-])C(=O)OC3CCCCC3
Formula C18H21N3O5
Molecular Weight 359.38 da
Stereocenters 0/1