Molecular Definition

Canonical SMILES Cc1cc2c(C)c(O)c(O)c(C(=O)O)c2cc1Cc3ccccc3
Formula C20H18O4
Molecular Weight 322.35 da
Stereocenters 0/0