Molecular Definition

Canonical SMILES CC(C)S(=O)(=O)NCC(C)c1ccc(cc1)c2ccc(cc2)C#N
Formula C19H22N2O2S
Molecular Weight 342.46 da
Stereocenters 0/1