Molecular Definition

Canonical SMILES CCCCCCCCn1c(C)c(C(=O)C(=O)N)c2c(OCC(=O)O)cccc12
Formula C21H28N2O5
Molecular Weight 388.46 da
Stereocenters 0/0