Molecular Definition

Canonical SMILES COc1ccccc1CCN2CCC3(CC2)CC(=O)c4ccc(NS(=O)(=O)C)cc4O3
Formula C23H28N2O5S
Molecular Weight 444.54 da
Stereocenters 0/0