Molecular Definition

Canonical SMILES COc1ccccc1N2CCN(CC2)C(=O)Nc3ccc(OC)c(c3)N4CCN(C)CC4.OC(=O)\C=C\C(=O)O
Formula C28H37N5O7
Molecular Weight 555.62 da
Stereocenters 0/0