Target Relevance

Molecular Definition

Canonical SMILES CNC1=C(Nc2cc(C)ccc2OCC(=O)N3CCN(Cc4ccc(F)cc4)C[C@H]3C)C(=O)C1=O
Formula C26H29FN4O4
Molecular Weight 480.53 da
Stereocenters 1/1