Molecular Definition

Canonical SMILES OCCSC1=C(SCCO)C(=O)c2ccccc2C1=O
Formula C14H14O4S2
Molecular Weight 310.39 da
Stereocenters 0/0