Target Relevance

Molecular Definition

Canonical SMILES CC(C)[C@@H](CNc1ccc(OC(F)(F)F)cc1)NC(=O)[C@H](CC2CCCCC2)CC(=O)N3CCOCC3
Formula C27H40F3N3O4
Molecular Weight 527.62 da
Stereocenters 2/2