Target Relevance

Molecular Definition

Canonical SMILES CC(C)C[C@H]1N([C@H](C(=O)NC(C)C)c2ccc(F)cc2)C(=O)[C@H](NC1=O)C3Cc4ccccc4C3
Formula C28H34FN3O3
Molecular Weight 479.59 da
Stereocenters 3/3