Target Relevance

Molecular Definition

Canonical SMILES CS(=O)(=O)O.NC(=N)NC(=O)c1cc2c(cccc2s1)c3cc(Cl)cc(Cl)c3
Formula C17H15Cl2N3O4S2
Molecular Weight 460.36 da
Stereocenters 0/0