Molecular Definition

Canonical SMILES C1CCC(CC1)Oc2nccc(n2)c3cnc(Nc4ccccn4)s3
Formula C18H19N5OS
Molecular Weight 353.44 da
Stereocenters 0/0