Molecular Definition

Canonical SMILES CCNC(=O)Nc1nc2cc(N)ncc2cc1c3cc(OC)cc(OC)c3
Formula C19H21N5O3
Molecular Weight 367.40 da
Stereocenters 0/0