Molecular Definition

Canonical SMILES CCCc1cc(Oc2ccc(Cl)cc2)ccc1OCCCOc3cccc(c3)C4SC(=O)NC4=O
Formula C27H26ClNO5S
Molecular Weight 512.02 da
Stereocenters 0/1