Molecular Definition

Canonical SMILES CCCCOc1ccc(cc1)S(=O)(=O)C2(CCN(CCCC)CC2)C(=O)NO
Formula C20H32N2O5S
Molecular Weight 412.54 da
Stereocenters 0/0