Molecular Definition

Canonical SMILES CCS(=O)(=O)c1ccc(OC)c(c1)c2ccc(CN3CCc4ccccc4C3)[nH]2
Formula C23H26N2O3S
Molecular Weight 410.53 da
Stereocenters 0/0