Target Relevance

Molecular Definition

Canonical SMILES CCOC(=O)[C@H]1CN(CCCCN2C(=O)c3cc(Cl)ccc3S2(=O)=O)CC[C@@H]1c4ccccc4
Formula C25H29ClN2O5S
Molecular Weight 505.03 da
Stereocenters 2/2