Molecular Definition

Canonical SMILES CC(=O)NCCNCc1ccc(cc1)c2cc3nccc(Nc4ccc5[nH]ccc5c4)c3s2
Formula C26H25N5OS
Molecular Weight 455.58 da
Stereocenters 0/0