Molecular Definition

Canonical SMILES C1CC(=CCN1)c2c([nH]c3ccccc23)c4ccccc4
Formula C19H18N2
Molecular Weight 274.36 da
Stereocenters 0/0