Molecular Definition

Canonical SMILES CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CCC(=O)N)NC(=O)COCC(=O)Nc4ccc(CC(CNCCN)CNCCN)cc4)C(C)C)C(=O)N
Formula C61H94N18O12S
Molecular Weight 1303.58 da
Stereocenters 7/7