Target Relevance

Molecular Definition

Canonical SMILES CC(C)NCc1ccc(C[C@@H]2NC(=O)[C@H](Cc3c[nH]c4ccccc34)NC(=O)[C@H]5CCC(=O)NCCCCC[C@@H](NC(=O)[C@H](Cc6ccccc6)NC(=O)[C@H](NC2=O)[C@@H](C)O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CSSC[C@@H](NC(=O)[C@@H](N)Cc7ccc(O)cc7)C(=O)N[C@H](CCCCN)C(=O)N[C@H](Cc8ccccc8)C(=O)N5)C(=O)O)cc1
Formula C82H108N16O17S2
Molecular Weight 1653.96 da
Stereocenters 13/13