Target Relevance

Molecular Definition

Canonical SMILES CN1CCC(=CC1)c2cn(C(=O)c3ccccc3)c4ccccc24
Formula C21H20N2O
Molecular Weight 316.40 da
Stereocenters 0/0