Molecular Definition

Canonical SMILES CC1(C)OCC(Br)(CO1)[N+](=O)[O-]
Formula C6H10BrNO4
Molecular Weight 240.05 da
Stereocenters 0/0