Molecular Definition

Canonical SMILES CC(C)(C)c1nc2CCNCc2c(n1)c3ccc(F)cc3
Formula C17H20FN3
Molecular Weight 285.36 da
Stereocenters 0/0