Molecular Definition

Canonical SMILES CC(C)(C)OC(=O)N[C@H](Cc1ccc(F)cc1C(F)(F)F)C(=O)NCc2nc3cccnc3n2C4(CC4)c5ccccc5
Formula C31H31F4N5O3
Molecular Weight 597.60 da
Stereocenters 1/1