Molecular Definition

Canonical SMILES Fc1cccc(F)c1C[C@@H](NC(=O)C2(CC2)C(F)(F)F)C(=O)NCc3nc4cccnc4n3C5(CC5)c6ccccc6
Formula C30H26F5N5O2
Molecular Weight 583.55 da
Stereocenters 1/1