Molecular Definition

Canonical SMILES CCOc1ccc(cc1)c2ccc(OCC(CN3C(=O)NC(C)(C)C3=O)N(O)C=O)cc2
Formula C23H27N3O6
Molecular Weight 441.48 da
Stereocenters 0/1