Target Relevance

Molecular Definition

Canonical SMILES CCOP(=O)(OCC)c1ccc(NC(=O)[C@@](C)(NC[C@H](O)c2ccc(O)c(NS(=O)(=O)C)c2)c3ccc(OC)cc3)cc1
Formula C29H38N3O9PS
Molecular Weight 635.67 da
Stereocenters 2/2