Target Relevance

Molecular Definition

Canonical SMILES COCc1cccc2[nH]c(nc12)c3n[nH]c4ncc(cc34)c5cccnc5
Formula C20H16N6O
Molecular Weight 356.38 da
Stereocenters 0/0