Molecular Definition

Canonical SMILES FC(F)(F)c1ccccc1C[C@@H](NC(=O)C2(CC2)C(F)(F)F)C(=O)NCc3nc4cccnc4n3C5(CC5)c6ccccc6
Formula C31H27F6N5O2
Molecular Weight 615.57 da
Stereocenters 1/1