Molecular Definition

Canonical SMILES CC1(CC1)C(=O)N[C@H](Cc2ccccc2C(F)(F)F)C(=O)NCc3nc4cccnc4n3C5(CC5)c6ccccc6
Formula C31H30F3N5O2
Molecular Weight 561.60 da
Stereocenters 1/1