Target Relevance

Molecular Definition

Canonical SMILES CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1ccccc1c2ccccc2)C(=O)O
Formula C21H25NO3S
Molecular Weight 371.49 da
Stereocenters 3/3