Molecular Definition

Canonical SMILES CC(C)c1cc2CCN(C)CCc2cc1NS(=O)(=O)c3ccc(cc3)c4ccc(Cl)cc4
Formula C26H29ClN2O2S
Molecular Weight 469.04 da
Stereocenters 0/0