Target Relevance

Molecular Definition

Canonical SMILES CNc1cc(oc1C(=O)N=C(N)N)c2cccc(Cl)c2
Formula C13H13ClN4O2
Molecular Weight 292.72 da
Stereocenters 0/0