Molecular Definition

Canonical SMILES COc1ccccc1CCN(C2CCNC2)C(=O)c3ccc(CN4CCCCC4)cc3
Formula C26H35N3O2
Molecular Weight 421.58 da
Stereocenters 0/1