Molecular Definition

Canonical SMILES COc1ccccc1CCN(C2CCNC2)C(=O)c3ccc(OCc4ccccc4)cc3
Formula C27H30N2O3
Molecular Weight 430.54 da
Stereocenters 0/1