Molecular Definition

Canonical SMILES Cc1ccc2c(OCCN3CCC(Cc4ccc5OCC(=O)Nc5c4F)CC3)cc(F)cc2n1
Formula C26H27F2N3O3
Molecular Weight 467.51 da
Stereocenters 0/0