Molecular Definition

Canonical SMILES CC(C)Oc1ccccc1N2CCN(CC2)[C@@H]3CC[C@H](CC3)NS(=O)(=O)c4ccc(OC(F)(F)F)cc4
Formula C26H34F3N3O4S
Molecular Weight 541.63 da
Stereocenters 2/2