Target Relevance

Molecular Definition

Canonical SMILES CCC(N1C=C(N=C(NCCc2cccs2)C1=O)C(C)(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)CCCc3ccccc3
Formula C31H40N4O5S
Molecular Weight 580.74 da
Stereocenters 1/2