Target Relevance

Molecular Definition

Canonical SMILES CN1C(=O)C(=C(C#N)C#N)c2cc(ccc12)S(=O)(=O)N3CCC[C@H]3COc4ccccc4
Formula C23H20N4O4S
Molecular Weight 448.49 da
Stereocenters 1/1