Molecular Definition

Canonical SMILES S=C1O[C@@H]2CN1CC[C@@H]2Oc3ccccc3
Formula C12H13NO2S
Molecular Weight 235.30 da
Stereocenters 2/2