Target Relevance

Molecular Definition

Canonical SMILES NCCCCCN1Cc2[nH]c3ccccc3c2C[C@@H](NC(=O)Cc4ccccc4)C1=O
Formula C25H30N4O2
Molecular Weight 418.53 da
Stereocenters 1/1