Molecular Definition

Canonical SMILES OB(O)[C@@H]1CCCN1C(=O)CNC2CCCCCCC2
Formula C14H27BN2O3
Molecular Weight 282.19 da
Stereocenters 1/1