Molecular Definition

Canonical SMILES COC(=O)N(CC(=O)O)Cc1cc(OCc2nc(oc2C)c3ccc(Cl)cc3)ccc1F
Formula C22H20ClFN2O6
Molecular Weight 462.86 da
Stereocenters 0/0