Target Relevance

Molecular Definition

Canonical SMILES CCN(C(=O)c1ccccc1OC)c2cc3N(C)C(=O)N(C)c3cc2N4CCNC[C@H]4C
Formula C24H31N5O3
Molecular Weight 437.53 da
Stereocenters 1/1