Target Relevance

Molecular Definition

Canonical SMILES C[C@H](c1ccc2NC(=O)Sc2c1)c3ccn(n3)c4ccc(OCCO)cn4
Formula C19H18N4O3S
Molecular Weight 382.44 da
Stereocenters 1/1