Target Relevance

Molecular Definition

Canonical SMILES CCN1CCN(CC1)\C=C\2/CCN3C2=NC(=O)c4c(Cl)cccc34
Formula C18H21ClN4O
Molecular Weight 344.84 da
Stereocenters 0/0