Molecular Definition

Canonical SMILES CN1CCN(CC1)C(=O)c2ccc(NC(=O)c3csc4C(=O)NC=Nc34)c(Br)c2
Formula C19H18BrN5O3S
Molecular Weight 476.35 da
Stereocenters 0/0