Target Relevance

Molecular Definition

Canonical SMILES COc1cccc(c1)C2=Nc3ccccc3C(=S)N2
Formula C15H12N2OS
Molecular Weight 268.33 da
Stereocenters 0/0